C25H25N3O3 — CID 55633340
N-[3-(4-phenylmethoxypiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide (PubChem CID 55633340) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[3-(4-phenylmethoxypiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-(4-phenylmethoxypiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55633340 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[3-(4-phenylmethoxypiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCC(OCc3ccccc3)CC2)c1)c1cccnc1 |
| InChI | InChI=1S/C25H25N3O3/c29-24(21-9-5-13-26-17-21)27-22-10-4-8-20(16-22)25(30)28-14-11-23(12-15-28)31-18-19-6-2-1-3-7-19/h1-10,13,16-17,23H,11-12,14-15,18H2,(H,27,29) |
| InChIKey | INNRWCNILHHLKO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |