C24H24N4O4S — CID 55634720
N-[3-[4-(benzenesulfonamido)piperidine-1-carbonyl]phenyl]pyridine-3-carboxamide (PubChem CID 55634720) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[3-[4-(benzenesulfonamido)piperidine-1-carbonyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[4-(benzenesulfonamido)piperidine-1-carbonyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55634720 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[3-[4-(benzenesulfonamido)piperidine-1-carbonyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCC(NS(=O)(=O)c3ccccc3)CC2)c1)c1cccnc1 |
| InChI | InChI=1S/C24H24N4O4S/c29-23(19-7-5-13-25-17-19)26-21-8-4-6-18(16-21)24(30)28-14-11-20(12-15-28)27-33(31,32)22-9-2-1-3-10-22/h1-10,13,16-17,20,27H,11-12,14-15H2,(H,26,29) |
| InChIKey | UFKKWGWFJKFZFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |