C18H22ClNO4 — CID 117068713
(1-phenoxy-3-pyrrolidin-1-ylpropan-2-yl) furan-2-carboxylate;hydrochloride (PubChem CID 117068713) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is (1-phenoxy-3-pyrrolidin-1-ylpropan-2-yl) furan-2-carboxylate;hydrochloride.
| Compound Name | (1-phenoxy-3-pyrrolidin-1-ylpropan-2-yl) furan-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 117068713 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (1-phenoxy-3-pyrrolidin-1-ylpropan-2-yl) furan-2-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OC(COc1ccccc1)CN1CCCC1)c1ccco1 |
| InChI | InChI=1S/C18H21NO4.ClH/c20-18(17-9-6-12-21-17)23-16(13-19-10-4-5-11-19)14-22-15-7-2-1-3-8-15;/h1-3,6-9,12,16H,4-5,10-11,13-14H2;1H |
| InChIKey | BVFDTPZGNWOYAR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |