C26H33NO5 — CID 3070728
4-oxo-4-[1-[2-(2-phenylethyl)phenoxy]-3-piperidin-1-ylpropan-2-yl]oxybutanoic acid (PubChem CID 3070728) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is 4-oxo-4-[1-[2-(2-phenylethyl)phenoxy]-3-piperidin-1-ylpropan-2-yl]oxybutanoic acid.
| Compound Name | 4-oxo-4-[1-[2-(2-phenylethyl)phenoxy]-3-piperidin-1-ylpropan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 3070728 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 4-oxo-4-[1-[2-(2-phenylethyl)phenoxy]-3-piperidin-1-ylpropan-2-yl]oxybutanoic acid |
| SMILES | O=C(O)CCC(=O)OC(COc1ccccc1CCc1ccccc1)CN1CCCCC1 |
| InChI | InChI=1S/C26H33NO5/c28-25(29)15-16-26(30)32-23(19-27-17-7-2-8-18-27)20-31-24-12-6-5-11-22(24)14-13-21-9-3-1-4-10-21/h1,3-6,9-12,23H,2,7-8,13-20H2,(H,28,29) |
| InChIKey | DMVQJQULWVUCHJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |