C81H105N3O18 — CID 159948148
4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-piperidin-1-ylpropan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 159948148) has the molecular formula C81H105N3O18 and a molecular weight of 1408.73 g/mol. Its IUPAC name is 4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-piperidin-1-ylpropan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-piperidin-1-ylpropan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 159948148 |
| Molecular Formula | C81H105N3O18 |
| Molecular Weight | 1408.73 g/mol |
| Exact Mass | 1407.74 |
| IUPAC Name | 4-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-piperidin-1-ylpropan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | COc1cccc(CCc2ccccc2OCC(CN2CCCCC2)OC(=O)CCC(=O)O)c1.COc1cccc(CCc2ccccc2OCC(CN2CCCCC2)OC(=O)CCC(=O)O)c1.COc1cccc(CCc2ccccc2OCC(CN2CCCCC2)OC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/3C27H35NO6/c3*1-32-23-10-7-8-21(18-23)12-13-22-9-3-4-11-25(22)33-20-24(19-28-16-5-2-6-17-28)34-27(31)15-14-26(29)30/h3*3-4,7-11,18,24H,2,5-6,12-17,19-20H2,1H3,(H,29,30) |
| InChIKey | OBTFMSPTDFHXKL-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 255.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 102 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1408.73 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|