C25H33NO5 — CID 23314070
3-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-yl]oxypropanoic acid (PubChem CID 23314070) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 3-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-yl]oxypropanoic acid.
| Compound Name | 3-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 23314070 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 3-[1-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-yl]oxypropanoic acid |
| SMILES | COc1cccc(CCc2ccccc2OCC(CN2CCCC2)OCCC(=O)O)c1 |
| InChI | InChI=1S/C25H33NO5/c1-29-22-9-6-7-20(17-22)11-12-21-8-2-3-10-24(21)31-19-23(30-16-13-25(27)28)18-26-14-4-5-15-26/h2-3,6-10,17,23H,4-5,11-16,18-19H2,1H3,(H,27,28) |
| InChIKey | VLNPXNRRPVXXBY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |