C29H41NO6 — CID 138717322
4-[1-(dimethylamino)-3-[2-[7-(3-methoxyphenyl)heptyl]phenoxy]propan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 138717322) has the molecular formula C29H41NO6 and a molecular weight of 499.65 g/mol. Its IUPAC name is 4-[1-(dimethylamino)-3-[2-[7-(3-methoxyphenyl)heptyl]phenoxy]propan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[1-(dimethylamino)-3-[2-[7-(3-methoxyphenyl)heptyl]phenoxy]propan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 138717322 |
| Molecular Formula | C29H41NO6 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 4-[1-(dimethylamino)-3-[2-[7-(3-methoxyphenyl)heptyl]phenoxy]propan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | COc1cccc(CCCCCCCc2ccccc2OCC(CN(C)C)OC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C29H41NO6/c1-30(2)21-26(36-29(33)19-18-28(31)32)22-35-27-17-10-9-15-24(27)14-8-6-4-5-7-12-23-13-11-16-25(20-23)34-3/h9-11,13,15-17,20,26H,4-8,12,14,18-19,21-22H2,1-3H3,(H,31,32) |
| InChIKey | WYRUJPHPNPLBES-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|