C27H37NO6 — CID 138717267
7-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-7-oxoheptanoic acid (PubChem CID 138717267) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is 7-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-7-oxoheptanoic acid.
| Compound Name | 7-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 138717267 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 7-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-7-oxoheptanoic acid |
| SMILES | COc1ccc(CCc2ccccc2OC[C@H](CN(C)C)OC(=O)CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C27H37NO6/c1-28(2)19-24(34-27(31)12-6-4-5-11-26(29)30)20-33-25-10-8-7-9-22(25)16-13-21-14-17-23(32-3)18-15-21/h7-10,14-15,17-18,24H,4-6,11-13,16,19-20H2,1-3H3,(H,29,30)/t24-/m0/s1 |
| InChIKey | PJQAYWZMHGPOCL-DEOSSOPVSA-N |
| XLogP | 4.37 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|