C24H29NO6 — CID 138717294
(E)-4-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 138717294) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (E)-4-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 138717294 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (E)-4-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(CCc2ccccc2OC[C@@H](CN(C)C)OC(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C24H29NO6/c1-25(2)16-21(31-24(28)15-14-23(26)27)17-30-22-7-5-4-6-19(22)11-8-18-9-12-20(29-3)13-10-18/h4-7,9-10,12-15,21H,8,11,16-17H2,1-3H3,(H,26,27)/b15-14+/t21-/m1/s1 |
| InChIKey | RTDSGMKBVRUPBD-IBUXMESJSA-N |
| XLogP | 2.97 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|