C22H27NO6 — CID 160583452
2-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-2-oxoacetic acid (PubChem CID 160583452) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-2-oxoacetic acid.
| Compound Name | 2-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-2-oxoacetic acid |
|---|---|
| PubChem CID | 160583452 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[(2R)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-2-oxoacetic acid |
| SMILES | COc1ccc(CCc2ccccc2OC[C@@H](CN(C)C)OC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C22H27NO6/c1-23(2)14-19(29-22(26)21(24)25)15-28-20-7-5-4-6-17(20)11-8-16-9-12-18(27-3)13-10-16/h4-7,9-10,12-13,19H,8,11,14-15H2,1-3H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | SITMCZAOTILKKK-LJQANCHMSA-N |
| XLogP | 2.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|