C26H37NO4 — CID 138717362
[1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] hexanoate (PubChem CID 138717362) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is [1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] hexanoate.
| Compound Name | [1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] hexanoate |
|---|---|
| PubChem CID | 138717362 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | [1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] hexanoate |
| SMILES | CCCCCC(=O)OC(COc1ccccc1CCc1ccc(OC)cc1)CN(C)C |
| InChI | InChI=1S/C26H37NO4/c1-5-6-7-12-26(28)31-24(19-27(2)3)20-30-25-11-9-8-10-22(25)16-13-21-14-17-23(29-4)18-15-21/h8-11,14-15,17-18,24H,5-7,12-13,16,19-20H2,1-4H3 |
| InChIKey | MFQGNWPBPRCBLA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|