C25H35NO4 — CID 138717473
[1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] pentanoate (PubChem CID 138717473) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is [1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] pentanoate.
| Compound Name | [1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] pentanoate |
|---|---|
| PubChem CID | 138717473 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | [1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] pentanoate |
| SMILES | CCCCC(=O)OC(COc1ccccc1CCc1ccc(OC)cc1)CN(C)C |
| InChI | InChI=1S/C25H35NO4/c1-5-6-11-25(27)30-23(18-26(2)3)19-29-24-10-8-7-9-21(24)15-12-20-13-16-22(28-4)17-14-20/h7-10,13-14,16-17,23H,5-6,11-12,15,18-19H2,1-4H3 |
| InChIKey | LAFNETCHHNFMGV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |