C23H31NO4 — CID 138717305
[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] propanoate (PubChem CID 138717305) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is [(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] propanoate.
| Compound Name | [(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] propanoate |
|---|---|
| PubChem CID | 138717305 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | [(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl] propanoate |
| SMILES | CCC(=O)O[C@H](COc1ccccc1CCc1ccc(OC)cc1)CN(C)C |
| InChI | InChI=1S/C23H31NO4/c1-5-23(25)28-21(16-24(2)3)17-27-22-9-7-6-8-19(22)13-10-18-11-14-20(26-4)15-12-18/h6-9,11-12,14-15,21H,5,10,13,16-17H2,1-4H3/t21-/m0/s1 |
| InChIKey | GXYSQPPYJXPCTR-NRFANRHFSA-N |
| XLogP | 3.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |