C26H35NO6 — CID 138717265
6-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-6-oxohexanoic acid (PubChem CID 138717265) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 6-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-6-oxohexanoic acid.
| Compound Name | 6-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 138717265 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 6-[(2S)-1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-6-oxohexanoic acid |
| SMILES | COc1ccc(CCc2ccccc2OC[C@H](CN(C)C)OC(=O)CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H35NO6/c1-27(2)18-23(33-26(30)11-7-6-10-25(28)29)19-32-24-9-5-4-8-21(24)15-12-20-13-16-22(31-3)17-14-20/h4-5,8-9,13-14,16-17,23H,6-7,10-12,15,18-19H2,1-3H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | XLDPFODCSFXDPP-QHCPKHFHSA-N |
| XLogP | 3.98 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|