C26H39NO4 — CID 146438482
1-[1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxyhexan-1-ol (PubChem CID 146438482) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxyhexan-1-ol.
| Compound Name | 1-[1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxyhexan-1-ol |
|---|---|
| PubChem CID | 146438482 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 1-[1-(dimethylamino)-3-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxyhexan-1-ol |
| SMILES | CCCCCC(O)OC(COc1ccccc1CCc1ccc(OC)cc1)CN(C)C |
| InChI | InChI=1S/C26H39NO4/c1-5-6-7-12-26(28)31-24(19-27(2)3)20-30-25-11-9-8-10-22(25)16-13-21-14-17-23(29-4)18-15-21/h8-11,14-15,17-18,24,26,28H,5-7,12-13,16,19-20H2,1-4H3 |
| InChIKey | ZBJZRZZEMGNTSQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|