C26H37NO6 — CID 166677722
[1-(dimethylamino)-3-[2-[4-(3-methoxyphenyl)butyl]phenoxy]propan-2-yl] 4,4-dihydroxybutanoate (PubChem CID 166677722) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is [1-(dimethylamino)-3-[2-[4-(3-methoxyphenyl)butyl]phenoxy]propan-2-yl] 4,4-dihydroxybutanoate.
| Compound Name | [1-(dimethylamino)-3-[2-[4-(3-methoxyphenyl)butyl]phenoxy]propan-2-yl] 4,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 166677722 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | [1-(dimethylamino)-3-[2-[4-(3-methoxyphenyl)butyl]phenoxy]propan-2-yl] 4,4-dihydroxybutanoate |
| SMILES | COc1cccc(CCCCc2ccccc2OCC(CN(C)C)OC(=O)CCC(O)O)c1 |
| InChI | InChI=1S/C26H37NO6/c1-27(2)18-23(33-26(30)16-15-25(28)29)19-32-24-14-7-6-12-21(24)11-5-4-9-20-10-8-13-22(17-20)31-3/h6-8,10,12-14,17,23,25,28-29H,4-5,9,11,15-16,18-19H2,1-3H3 |
| InChIKey | UWWHPSFLOGFLNN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|