C8H14Cl2N2O3 — CID 139769684
1,3-diaminopropan-2-yl furan-2-carboxylate;dihydrochloride (PubChem CID 139769684) has the molecular formula C8H14Cl2N2O3 and a molecular weight of 257.12 g/mol. Its IUPAC name is 1,3-diaminopropan-2-yl furan-2-carboxylate;dihydrochloride.
| Compound Name | 1,3-diaminopropan-2-yl furan-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 139769684 |
| Molecular Formula | C8H14Cl2N2O3 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 1,3-diaminopropan-2-yl furan-2-carboxylate;dihydrochloride |
| SMILES | Cl.Cl.NCC(CN)OC(=O)c1ccco1 |
| InChI | InChI=1S/C8H12N2O3.2ClH/c9-4-6(5-10)13-8(11)7-2-1-3-12-7;;/h1-3,6H,4-5,9-10H2;2*1H |
| InChIKey | OOGJACVGOHOYGR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |