About 1-chloropentyl furan-2-carboxylate
1-chloropentyl furan-2-carboxylate (PubChem CID 174368283) has the molecular formula C10H13ClO3
and a molecular weight of 216.66 g/mol. Its IUPAC name is 1-chloropentyl furan-2-carboxylate.
Molecular Properties
| Compound Name | 1-chloropentyl furan-2-carboxylate |
| PubChem CID | 174368283 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-chloropentyl furan-2-carboxylate |
| SMILES | CCCCC(Cl)OC(=O)c1ccco1 |
| InChI | InChI=1S/C10H13ClO3/c1-2-3-6-9(11)14-10(12)8-5-4-7-13-8/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | JPVLICSQORHCHC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentyl furan-2-carboxylate?
The IUPAC name of 1-chloropentyl furan-2-carboxylate (CID 174368283) is 1-chloropentyl furan-2-carboxylate.
What is the SMILES notation for 1-chloropentyl furan-2-carboxylate?
The canonical SMILES for 1-chloropentyl furan-2-carboxylate is CCCCC(Cl)OC(=O)c1ccco1.
What is the InChIKey of 1-chloropentyl furan-2-carboxylate?
The InChIKey is JPVLICSQORHCHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO3/c1-2-3-6-9(11)14-10(12)8-5-4-7-13-8/h4-5,7,9H,2-3,6H2,1H3.
What are the key properties of 1-chloropentyl furan-2-carboxylate?
1-chloropentyl furan-2-carboxylate has a molecular weight of 216.66 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentyl furan-2-carboxylate is sourced from PubChem (CID 174368283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).