C14H23N3O3 — CID 119667471
N-[1-(1-aminohexan-2-ylamino)-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 119667471) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[1-(1-aminohexan-2-ylamino)-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-(1-aminohexan-2-ylamino)-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119667471 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-[1-(1-aminohexan-2-ylamino)-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CCCCC(CN)NC(=O)C(C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H23N3O3/c1-3-4-6-11(9-15)17-13(18)10(2)16-14(19)12-7-5-8-20-12/h5,7-8,10-11H,3-4,6,9,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | QZZPGAOFDFANBU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |