C20H27N3O5 — CID 119666392
N-[2-(1-aminohexan-2-ylcarbamoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide (PubChem CID 119666392) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[2-(1-aminohexan-2-ylcarbamoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[2-(1-aminohexan-2-ylcarbamoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119666392 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[2-(1-aminohexan-2-ylcarbamoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide |
| SMILES | CCCCC(CN)NC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H27N3O5/c1-4-5-7-13(12-21)22-19(24)14-10-17(26-2)18(27-3)11-15(14)23-20(25)16-8-6-9-28-16/h6,8-11,13H,4-5,7,12,21H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | MGNOCIOLZSQMJL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |