C16H17NO7 — CID 24530674
2-hydroxyethyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate (PubChem CID 24530674) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2-hydroxyethyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate.
| Compound Name | 2-hydroxyethyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 24530674 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-hydroxyethyl 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)c2ccco2)c(C(=O)OCCO)cc1OC |
| InChI | InChI=1S/C16H17NO7/c1-21-13-8-10(16(20)24-7-5-18)11(9-14(13)22-2)17-15(19)12-4-3-6-23-12/h3-4,6,8-9,18H,5,7H2,1-2H3,(H,17,19) |
| InChIKey | SBQAXBQSHNFOKV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |