C17H22ClN3O5 — CID 119501659
N-[4,5-dimethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl]furan-2-carboxamide;hydrochloride (PubChem CID 119501659) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[4,5-dimethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119501659 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[4,5-dimethoxy-2-[2-(methylamino)ethylcarbamoyl]phenyl]furan-2-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccco1.Cl |
| InChI | InChI=1S/C17H21N3O5.ClH/c1-18-6-7-19-16(21)11-9-14(23-2)15(24-3)10-12(11)20-17(22)13-5-4-8-25-13;/h4-5,8-10,18H,6-7H2,1-3H3,(H,19,21)(H,20,22);1H |
| InChIKey | MUAHGMAOZBYUAZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|