C17H21N3O5S — CID 3169047
N-[2,5-dimethoxy-4-(2-methoxyethylcarbamothioylamino)phenyl]furan-2-carboxamide (PubChem CID 3169047) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-(2-methoxyethylcarbamothioylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[2,5-dimethoxy-4-(2-methoxyethylcarbamothioylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3169047 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[2,5-dimethoxy-4-(2-methoxyethylcarbamothioylamino)phenyl]furan-2-carboxamide |
| SMILES | COCCNC(=S)Nc1cc(OC)c(NC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C17H21N3O5S/c1-22-8-6-18-17(26)20-12-10-14(23-2)11(9-15(12)24-3)19-16(21)13-5-4-7-25-13/h4-5,7,9-10H,6,8H2,1-3H3,(H,19,21)(H2,18,20,26) |
| InChIKey | BSMXEVLQICNGDN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|