C20H16ClNO5 — CID 2989497
N-[2-(2-chlorobenzoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide (PubChem CID 2989497) has the molecular formula C20H16ClNO5 and a molecular weight of 385.80 g/mol. Its IUPAC name is N-[2-(2-chlorobenzoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[2-(2-chlorobenzoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2989497 |
| Molecular Formula | C20H16ClNO5 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[2-(2-chlorobenzoyl)-4,5-dimethoxyphenyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccco2)c(C(=O)c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C20H16ClNO5/c1-25-17-10-13(19(23)12-6-3-4-7-14(12)21)15(11-18(17)26-2)22-20(24)16-8-5-9-27-16/h3-11H,1-2H3,(H,22,24) |
| InChIKey | GBLAILGGTQJUNJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |