C20H18N2O5 — CID 1026612
N-[2-[(2,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 1026612) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[2-[(2,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1026612 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[2-[(2,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2NC(=O)c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C20H18N2O5/c1-25-13-9-10-14(18(12-13)26-2)19(23)21-15-6-3-4-7-16(15)22-20(24)17-8-5-11-27-17/h3-12H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | VTLDMLKJJQWSCT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |