C20H24ClN3O5 — CID 120657177
N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,5-dimethoxyphenyl]furan-2-carboxamide;hydrochloride (PubChem CID 120657177) has the molecular formula C20H24ClN3O5 and a molecular weight of 421.88 g/mol. Its IUPAC name is N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,5-dimethoxyphenyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,5-dimethoxyphenyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120657177 |
| Molecular Formula | C20H24ClN3O5 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,5-dimethoxyphenyl]furan-2-carboxamide;hydrochloride |
| SMILES | COc1cc(NC(=O)c2ccco2)c(C(=O)N2C[C@H]3CNC[C@H]3C2)cc1OC.Cl |
| InChI | InChI=1S/C20H23N3O5.ClH/c1-26-17-6-14(20(25)23-10-12-8-21-9-13(12)11-23)15(7-18(17)27-2)22-19(24)16-4-3-5-28-16;/h3-7,12-13,21H,8-11H2,1-2H3,(H,22,24);1H/t12-,13+; |
| InChIKey | VIWKWTPEYZCSTO-OEEJBDNKSA-N |
| XLogP | 2.26 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |