C27H29N3O8 — CID 16534388
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate (PubChem CID 16534388) has the molecular formula C27H29N3O8 and a molecular weight of 523.54 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 16534388 |
| Molecular Formula | C27H29N3O8 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3cc(OC)c(OC)cc3NC(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C27H29N3O8/c1-34-19-8-6-18(7-9-19)29-10-12-30(13-11-29)25(31)17-38-27(33)20-15-23(35-2)24(36-3)16-21(20)28-26(32)22-5-4-14-37-22/h4-9,14-16H,10-13,17H2,1-3H3,(H,28,32) |
| InChIKey | INQRNWLHSSSJMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 119.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|