C24H33ClN4O3 — CID 70450403
3-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-ethoxypropyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 70450403) has the molecular formula C24H33ClN4O3 and a molecular weight of 461.01 g/mol. Its IUPAC name is 3-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-ethoxypropyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | 3-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-ethoxypropyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 70450403 |
| Molecular Formula | C24H33ClN4O3 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-ethoxypropyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | CCOC(CNC(=O)C1C2C=CC(C2)C1C(N)=O)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H33ClN4O3/c1-2-32-20(14-27-24(31)22-17-7-6-16(12-17)21(22)23(26)30)15-28-8-10-29(11-9-28)19-5-3-4-18(25)13-19/h3-7,13,16-17,20-22H,2,8-12,14-15H2,1H3,(H2,26,30)(H,27,31) |
| InChIKey | DTMUWRZHOQBSQQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|