C21H24ClN3O3 — CID 11463772
(1S,7R)-4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 11463772) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is (1S,7R)-4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,7R)-4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 11463772 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (1S,7R)-4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C(C(=O)N1OCCN1CCN(c3cccc(Cl)c3)CC1)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C21H24ClN3O3/c22-16-2-1-3-17(13-16)24-8-6-23(7-9-24)10-11-28-25-20(26)18-14-4-5-15(12-14)19(18)21(25)27/h1-5,13-15,18-19H,6-12H2/t14-,15+,18?,19? |
| InChIKey | KQONSXLQFOLHMD-MYMYQCDVSA-N |
| XLogP | 2.20 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|