C22H24N4O3 — CID 44515237
2-[4-[2-[[(1R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]oxy]ethyl]piperazin-1-yl]benzonitrile (PubChem CID 44515237) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[4-[2-[[(1R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]oxy]ethyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[2-[[(1R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]oxy]ethyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 44515237 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[4-[2-[[(1R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]oxy]ethyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(CCON2C(=O)C3C(C2=O)[C@H]2C=C[C@@H]3C2)CC1 |
| InChI | InChI=1S/C22H24N4O3/c23-14-17-3-1-2-4-18(17)25-9-7-24(8-10-25)11-12-29-26-21(27)19-15-5-6-16(13-15)20(19)22(26)28/h1-6,15-16,19-20H,7-13H2/t15-,16+,19?,20? |
| InChIKey | RXXMLSTVXWZYCG-BANKROOTSA-N |
| XLogP | 1.42 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|