C16H22N5OS+ — CID 7874412
N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 7874412) has the molecular formula C16H22N5OS+ and a molecular weight of 332.45 g/mol. Its IUPAC name is N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 7874412 |
| Molecular Formula | C16H22N5OS+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN(Cc1cccs1)C(=O)C[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H21N5OS/c1-19(12-14-4-2-11-23-14)15(22)13-20-7-9-21(10-8-20)16-17-5-3-6-18-16/h2-6,11H,7-10,12-13H2,1H3/p+1 |
| InChIKey | RMXCLROMCYHECE-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |