C13H13N5O2S2 — CID 95801873
N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 95801873) has the molecular formula C13H13N5O2S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 95801873 |
| Molecular Formula | C13H13N5O2S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCn1nnn(-c2cccs2)c1=O |
| InChI | InChI=1S/C13H13N5O2S2/c19-11(9-10-3-1-7-21-10)14-5-6-17-13(20)18(16-15-17)12-4-2-8-22-12/h1-4,7-8H,5-6,9H2,(H,14,19) |
| InChIKey | RIVKRDMGSOPBMQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |