C16H13N7O3S — CID 95801895
4-oxo-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-3H-phthalazine-1-carboxamide (PubChem CID 95801895) has the molecular formula C16H13N7O3S and a molecular weight of 383.39 g/mol. Its IUPAC name is 4-oxo-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 95801895 |
| Molecular Formula | C16H13N7O3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-oxo-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)ethyl]-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NCCn1nnn(-c2cccs2)c1=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H13N7O3S/c24-14-11-5-2-1-4-10(11)13(18-19-14)15(25)17-7-8-22-16(26)23(21-20-22)12-6-3-9-27-12/h1-6,9H,7-8H2,(H,17,25)(H,19,24) |
| InChIKey | ZFFKITAWKAVRJY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |