C14H13N3O2 — CID 103708902
4-oxo-N-pent-4-ynyl-3H-phthalazine-1-carboxamide (PubChem CID 103708902) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-oxo-N-pent-4-ynyl-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-pent-4-ynyl-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 103708902 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-oxo-N-pent-4-ynyl-3H-phthalazine-1-carboxamide |
| SMILES | C#CCCCNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C14H13N3O2/c1-2-3-6-9-15-14(19)12-10-7-4-5-8-11(10)13(18)17-16-12/h1,4-5,7-8H,3,6,9H2,(H,15,19)(H,17,18) |
| InChIKey | DXUNOXCOZIHGSP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|