C16H14N4O4 — CID 24683439
N-[2-(furan-2-carbonylamino)ethyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 24683439) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 24683439 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NCCNC(=O)c1n[nH]c(=O)c2ccccc12)c1ccco1 |
| InChI | InChI=1S/C16H14N4O4/c21-14-11-5-2-1-4-10(11)13(19-20-14)16(23)18-8-7-17-15(22)12-6-3-9-24-12/h1-6,9H,7-8H2,(H,17,22)(H,18,23)(H,20,21) |
| InChIKey | KGBOECYPPWQODG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|