C24H20N4O2S — CID 55652639
4-oxo-N-(3-phenothiazin-10-ylpropyl)-3H-phthalazine-1-carboxamide (PubChem CID 55652639) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-oxo-N-(3-phenothiazin-10-ylpropyl)-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-(3-phenothiazin-10-ylpropyl)-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55652639 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-oxo-N-(3-phenothiazin-10-ylpropyl)-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NCCCN1c2ccccc2Sc2ccccc21)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C24H20N4O2S/c29-23-17-9-2-1-8-16(17)22(26-27-23)24(30)25-14-7-15-28-18-10-3-5-12-20(18)31-21-13-6-4-11-19(21)28/h1-6,8-13H,7,14-15H2,(H,25,30)(H,27,29) |
| InChIKey | SXKBXWGAFRVGEU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|