C20H21N3O2S — CID 96559582
(2R)-5-oxo-N-(3-phenothiazin-10-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 96559582) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2R)-5-oxo-N-(3-phenothiazin-10-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-5-oxo-N-(3-phenothiazin-10-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 96559582 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R)-5-oxo-N-(3-phenothiazin-10-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)NCCCN2c3ccccc3Sc3ccccc32)N1 |
| InChI | InChI=1S/C20H21N3O2S/c24-19-11-10-14(22-19)20(25)21-12-5-13-23-15-6-1-3-8-17(15)26-18-9-4-2-7-16(18)23/h1-4,6-9,14H,5,10-13H2,(H,21,25)(H,22,24)/t14-/m1/s1 |
| InChIKey | NMHOAXZIBOEWOX-CQSZACIVSA-N |
| XLogP | 3.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|