C22H27N3O3S2 — CID 90259864
N-[3-(2-methylsulfonylphenothiazin-10-yl)propyl]piperidine-4-carboxamide (PubChem CID 90259864) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[3-(2-methylsulfonylphenothiazin-10-yl)propyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(2-methylsulfonylphenothiazin-10-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90259864 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[3-(2-methylsulfonylphenothiazin-10-yl)propyl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)N(CCCNC(=O)C1CCNCC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H27N3O3S2/c1-30(27,28)17-7-8-21-19(15-17)25(18-5-2-3-6-20(18)29-21)14-4-11-24-22(26)16-9-12-23-13-10-16/h2-3,5-8,15-16,23H,4,9-14H2,1H3,(H,24,26) |
| InChIKey | KEGGKVUOTPOZGQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|