C12H17ClN2O3S — CID 81201070
4-chloro-3-[(4-methylmorpholin-2-yl)methylsulfonyl]aniline (PubChem CID 81201070) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 4-chloro-3-[(4-methylmorpholin-2-yl)methylsulfonyl]aniline.
| Compound Name | 4-chloro-3-[(4-methylmorpholin-2-yl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 81201070 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-chloro-3-[(4-methylmorpholin-2-yl)methylsulfonyl]aniline |
| SMILES | CN1CCOC(CS(=O)(=O)c2cc(N)ccc2Cl)C1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-15-4-5-18-10(7-15)8-19(16,17)12-6-9(14)2-3-11(12)13/h2-3,6,10H,4-5,7-8,14H2,1H3 |
| InChIKey | JPVXFVUHZYZHLG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|