C14H18ClNO5S — CID 167944826
(4-methylmorpholin-2-yl)methyl 2-chloro-5-methylsulfonylbenzoate (PubChem CID 167944826) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is (4-methylmorpholin-2-yl)methyl 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | (4-methylmorpholin-2-yl)methyl 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 167944826 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (4-methylmorpholin-2-yl)methyl 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CN1CCOC(COC(=O)c2cc(S(C)(=O)=O)ccc2Cl)C1 |
| InChI | InChI=1S/C14H18ClNO5S/c1-16-5-6-20-10(8-16)9-21-14(17)12-7-11(22(2,18)19)3-4-13(12)15/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | XFTMZSRSLKCJDD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |