C13H16ClNO5S — CID 107090402
2-chloro-4-[(4-methylmorpholin-2-yl)methylsulfonyl]benzoic acid (PubChem CID 107090402) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is 2-chloro-4-[(4-methylmorpholin-2-yl)methylsulfonyl]benzoic acid.
| Compound Name | 2-chloro-4-[(4-methylmorpholin-2-yl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 107090402 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-chloro-4-[(4-methylmorpholin-2-yl)methylsulfonyl]benzoic acid |
| SMILES | CN1CCOC(CS(=O)(=O)c2ccc(C(=O)O)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16ClNO5S/c1-15-4-5-20-9(7-15)8-21(18,19)10-2-3-11(13(16)17)12(14)6-10/h2-3,6,9H,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | KLSXKLINGVKYNJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |