C14H20N2O4 — CID 79182993
(4-methylmorpholin-2-yl)methyl 5-amino-2-methoxybenzoate (PubChem CID 79182993) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (4-methylmorpholin-2-yl)methyl 5-amino-2-methoxybenzoate.
| Compound Name | (4-methylmorpholin-2-yl)methyl 5-amino-2-methoxybenzoate |
|---|---|
| PubChem CID | 79182993 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (4-methylmorpholin-2-yl)methyl 5-amino-2-methoxybenzoate |
| SMILES | COc1ccc(N)cc1C(=O)OCC1CN(C)CCO1 |
| InChI | InChI=1S/C14H20N2O4/c1-16-5-6-19-11(8-16)9-20-14(17)12-7-10(15)3-4-13(12)18-2/h3-4,7,11H,5-6,8-9,15H2,1-2H3 |
| InChIKey | GFLBWRHYWOKDTQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|