C15H24N4O3 — CID 111091298
1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 111091298) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111091298 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2CN(C)CCO2)cc1OC |
| InChI | InChI=1S/C15H24N4O3/c1-19-6-7-22-12(10-19)9-17-15(16)18-11-4-5-13(20-2)14(8-11)21-3/h4-5,8,12H,6-7,9-10H2,1-3H3,(H3,16,17,18) |
| InChIKey | NONPQUVRTAHVIQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|