C15H25IN4O3 — CID 111091297
1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111091297) has the molecular formula C15H25IN4O3 and a molecular weight of 436.29 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111091297 |
| Molecular Formula | C15H25IN4O3 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC2CN(C)CCO2)cc1OC.I |
| InChI | InChI=1S/C15H24N4O3.HI/c1-19-6-7-22-12(10-19)9-17-15(16)18-11-4-5-13(20-2)14(8-11)21-3;/h4-5,8,12H,6-7,9-10H2,1-3H3,(H3,16,17,18);1H |
| InChIKey | TWBIVNIYDFQKKG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|