C7H17N5O — CID 79071224
1-amino-2-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 79071224) has the molecular formula C7H17N5O and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-amino-2-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 1-amino-2-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 79071224 |
| Molecular Formula | C7H17N5O |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-amino-2-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | CN1CCOC(C/N=C(\N)NN)C1 |
| InChI | InChI=1S/C7H17N5O/c1-12-2-3-13-6(5-12)4-10-7(8)11-9/h6H,2-5,9H2,1H3,(H3,8,10,11) |
| InChIKey | IYVNSTDJLODHQT-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|