About [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate
[(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate (PubChem CID 170320181) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate.
Molecular Properties
| Compound Name | [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate |
| PubChem CID | 170320181 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate |
| SMILES | C/N=C(\N)OC[C@@H]1CN(C)CCO1 |
| InChI | InChI=1S/C8H17N3O2/c1-10-8(9)13-6-7-5-11(2)3-4-12-7/h7H,3-6H2,1-2H3,(H2,9,10)/t7-/m0/s1 |
| InChIKey | ACRLXDXKTGYRLG-ZETCQYMHSA-N |
| XLogP | -0.72 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate?
The IUPAC name of [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate (CID 170320181) is [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate.
What is the SMILES notation for [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate?
The canonical SMILES for [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate is C/N=C(\N)OC[C@@H]1CN(C)CCO1.
What is the InChIKey of [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate?
The InChIKey is ACRLXDXKTGYRLG-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-10-8(9)13-6-7-5-11(2)3-4-12-7/h7H,3-6H2,1-2H3,(H2,9,10)/t7-/m0/s1.
What are the key properties of [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate?
[(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate has a molecular weight of 187.24 g/mol, XLogP of -0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-methylmorpholin-2-yl]methyl N'-methylcarbamimidate is sourced from PubChem (CID 170320181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).