C17H27N3O4 — CID 111036014
1-(3,4-dimethoxyphenyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111036014) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111036014 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCCOCC2CCCO2)cc1OC |
| InChI | InChI=1S/C17H27N3O4/c1-21-15-7-6-13(11-16(15)22-2)20-17(18)19-8-4-9-23-12-14-5-3-10-24-14/h6-7,11,14H,3-5,8-10,12H2,1-2H3,(H3,18,19,20) |
| InChIKey | LHMXUBCBGCKIFU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|