C14H22N2O3 — CID 79166947
[4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanamine (PubChem CID 79166947) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is [4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanamine.
| Compound Name | [4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 79166947 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanamine |
| SMILES | COc1ccc(CN)cc1OCC1CN(C)CCO1 |
| InChI | InChI=1S/C14H22N2O3/c1-16-5-6-18-12(9-16)10-19-14-7-11(8-15)3-4-13(14)17-2/h3-4,7,12H,5-6,8-10,15H2,1-2H3 |
| InChIKey | FMRDOBUCNOVROB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |