C15H24N2O3 — CID 79172273
1-[4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]-N-methylmethanamine (PubChem CID 79172273) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]-N-methylmethanamine.
| Compound Name | 1-[4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 79172273 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[4-methoxy-3-[(4-methylmorpholin-2-yl)methoxy]phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OC)c(OCC2CN(C)CCO2)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-16-9-12-4-5-14(18-3)15(8-12)20-11-13-10-17(2)6-7-19-13/h4-5,8,13,16H,6-7,9-11H2,1-3H3 |
| InChIKey | CGAXJPBLMPCTPM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |