C16H25FN2O2 — CID 107687677
N-[[3-fluoro-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methyl]propan-2-amine (PubChem CID 107687677) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[[3-fluoro-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-fluoro-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107687677 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[[3-fluoro-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(OCC2CN(C)CCO2)c(F)c1 |
| InChI | InChI=1S/C16H25FN2O2/c1-12(2)18-9-13-4-5-16(15(17)8-13)21-11-14-10-19(3)6-7-20-14/h4-5,8,12,14,18H,6-7,9-11H2,1-3H3 |
| InChIKey | BDAQNZYUFBVNNV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |